C20H17N5OS — CID 168577708
N-[[4-(5-ethyl-1,3,4-oxadiazol-2-yl)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 168577708) has the molecular formula C20H17N5OS and a molecular weight of 375.46 g/mol. Its IUPAC name is N-[[4-(5-ethyl-1,3,4-oxadiazol-2-yl)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[[4-(5-ethyl-1,3,4-oxadiazol-2-yl)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168577708 |
| Molecular Formula | C20H17N5OS |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-[[4-(5-ethyl-1,3,4-oxadiazol-2-yl)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | CCc1nnc(-c2ccc(C=NNc3nc(-c4ccccc4)cs3)cc2)o1 |
| InChI | InChI=1S/C20H17N5OS/c1-2-18-23-24-19(26-18)16-10-8-14(9-11-16)12-21-25-20-22-17(13-27-20)15-6-4-3-5-7-15/h3-13H,2H2,1H3,(H,22,25) |
| InChIKey | BDUPNWTXNBIKGW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|