C17H12N3O2S- — CID 7822015
4-[(Z)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate (PubChem CID 7822015) has the molecular formula C17H12N3O2S- and a molecular weight of 322.37 g/mol. Its IUPAC name is 4-[(Z)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate.
| Compound Name | 4-[(Z)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 7822015 |
| Molecular Formula | C17H12N3O2S- |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 4-[(Z)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate |
| SMILES | O=C([O-])c1ccc(/C=N\Nc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C17H13N3O2S/c21-16(22)14-8-6-12(7-9-14)10-18-20-17-19-15(11-23-17)13-4-2-1-3-5-13/h1-11H,(H,19,20)(H,21,22)/p-1/b18-10- |
| InChIKey | BMFJBDIDPOTNEZ-ZDLGFXPLSA-M |
| XLogP | 2.62 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|