C26H23N3O4S — CID 168577769
methyl 4-[2-[4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]ethoxy]benzoate (PubChem CID 168577769) has the molecular formula C26H23N3O4S and a molecular weight of 473.55 g/mol. Its IUPAC name is methyl 4-[2-[4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]ethoxy]benzoate.
| Compound Name | methyl 4-[2-[4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 168577769 |
| Molecular Formula | C26H23N3O4S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | methyl 4-[2-[4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCOc2ccc(C=NNc3nc(-c4ccccc4)cs3)cc2)cc1 |
| InChI | InChI=1S/C26H23N3O4S/c1-31-25(30)21-9-13-23(14-10-21)33-16-15-32-22-11-7-19(8-12-22)17-27-29-26-28-24(18-34-26)20-5-3-2-4-6-20/h2-14,17-18H,15-16H2,1H3,(H,28,29) |
| InChIKey | IGDIDQCGGADVAG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|