C23H16ClN3O2S — CID 91823828
[4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 91823828) has the molecular formula C23H16ClN3O2S and a molecular weight of 433.92 g/mol. Its IUPAC name is [4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 91823828 |
| Molecular Formula | C23H16ClN3O2S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | [4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | O=C(Oc1ccc(/C=N/Nc2nc(-c3ccccc3)cs2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H16ClN3O2S/c24-19-10-8-18(9-11-19)22(28)29-20-12-6-16(7-13-20)14-25-27-23-26-21(15-30-23)17-4-2-1-3-5-17/h1-15H,(H,26,27)/b25-14+ |
| InChIKey | DMNXPXMPEVSMPT-AFUMVMLFSA-N |
| XLogP | 6.13 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|