C24H18BrN3O3S — CID 3867217
[4-[[[4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 3867217) has the molecular formula C24H18BrN3O3S and a molecular weight of 508.40 g/mol. Its IUPAC name is [4-[[[4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [4-[[[4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 3867217 |
| Molecular Formula | C24H18BrN3O3S |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | [4-[[[4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C=NNc3nc(-c4ccc(Br)cc4)cs3)cc2)cc1 |
| InChI | InChI=1S/C24H18BrN3O3S/c1-30-20-12-6-18(7-13-20)23(29)31-21-10-2-16(3-11-21)14-26-28-24-27-22(15-32-24)17-4-8-19(25)9-5-17/h2-15H,1H3,(H,27,28) |
| InChIKey | AOFYOOAYMCYSOJ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|