C25H20BrN3O4S — CID 3892519
[4-[[[4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-methoxybenzoate (PubChem CID 3892519) has the molecular formula C25H20BrN3O4S and a molecular weight of 538.42 g/mol. Its IUPAC name is [4-[[[4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-methoxybenzoate.
| Compound Name | [4-[[[4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 3892519 |
| Molecular Formula | C25H20BrN3O4S |
| Molecular Weight | 538.42 g/mol |
| Exact Mass | 537.04 |
| IUPAC Name | [4-[[[4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-methoxybenzoate |
| SMILES | COc1cc(C=NNc2nc(-c3ccc(Br)cc3)cs2)ccc1OC(=O)c1ccccc1OC |
| InChI | InChI=1S/C25H20BrN3O4S/c1-31-21-6-4-3-5-19(21)24(30)33-22-12-7-16(13-23(22)32-2)14-27-29-25-28-20(15-34-25)17-8-10-18(26)11-9-17/h3-15H,1-2H3,(H,28,29) |
| InChIKey | VTJVBZOVGNNCIA-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.42 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|