C24H19N3O3S — CID 42421360
[2-methoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 42421360) has the molecular formula C24H19N3O3S and a molecular weight of 429.50 g/mol. Its IUPAC name is [2-methoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [2-methoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 42421360 |
| Molecular Formula | C24H19N3O3S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | [2-methoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | COc1cc(C=NNc2nc(-c3ccccc3)cs2)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H19N3O3S/c1-29-22-14-17(12-13-21(22)30-23(28)19-10-6-3-7-11-19)15-25-27-24-26-20(16-31-24)18-8-4-2-5-9-18/h2-16H,1H3,(H,26,27) |
| InChIKey | KSRXJUHVZBQQPN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|