C25H20ClN3O3S — CID 168578713
[2-ethoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate (PubChem CID 168578713) has the molecular formula C25H20ClN3O3S and a molecular weight of 477.97 g/mol. Its IUPAC name is [2-ethoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [2-ethoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 168578713 |
| Molecular Formula | C25H20ClN3O3S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | [2-ethoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| SMILES | CCOc1cc(C=NNc2nc(-c3ccccc3)cs2)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C25H20ClN3O3S/c1-2-31-23-14-17(12-13-22(23)32-24(30)19-10-6-7-11-20(19)26)15-27-29-25-28-21(16-33-25)18-8-4-3-5-9-18/h3-16H,2H2,1H3,(H,28,29) |
| InChIKey | GOHDDAJFVHHRJU-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|