C25H21ClN4O3S — CID 168579384
N-(2-chlorophenyl)-2-[2-methoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetamide (PubChem CID 168579384) has the molecular formula C25H21ClN4O3S and a molecular weight of 492.99 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[2-methoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[2-methoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 168579384 |
| Molecular Formula | C25H21ClN4O3S |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | N-(2-chlorophenyl)-2-[2-methoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetamide |
| SMILES | COc1cc(C=NNc2nc(-c3ccccc3)cs2)ccc1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C25H21ClN4O3S/c1-32-23-13-17(14-27-30-25-29-21(16-34-25)18-7-3-2-4-8-18)11-12-22(23)33-15-24(31)28-20-10-6-5-9-19(20)26/h2-14,16H,15H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | WEMMBGLSXBHNED-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|