C22H16N4O6S — CID 126067451
[2-methoxy-4-[(Z)-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 126067451) has the molecular formula C22H16N4O6S and a molecular weight of 464.46 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-methoxy-4-[(Z)-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126067451 |
| Molecular Formula | C22H16N4O6S |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | [2-methoxy-4-[(Z)-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | COc1cc(/C=N\Nc2nc(-c3ccc([N+](=O)[O-])cc3)cs2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C22H16N4O6S/c1-30-20-11-14(4-9-18(20)32-21(27)19-3-2-10-31-19)12-23-25-22-24-17(13-33-22)15-5-7-16(8-6-15)26(28)29/h2-13H,1H3,(H,24,25)/b23-12- |
| InChIKey | URPXTIPSAKFEIG-FMCGGJTJSA-N |
| XLogP | 4.99 |
| TPSA | 129.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|