C23H15ClFN3O2S — CID 41281015
[4-[(Z)-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 2-fluorobenzoate (PubChem CID 41281015) has the molecular formula C23H15ClFN3O2S and a molecular weight of 451.91 g/mol. Its IUPAC name is [4-[(Z)-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 2-fluorobenzoate.
| Compound Name | [4-[(Z)-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 41281015 |
| Molecular Formula | C23H15ClFN3O2S |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | [4-[(Z)-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 2-fluorobenzoate |
| SMILES | O=C(Oc1ccc(/C=N\Nc2nc(-c3ccc(Cl)cc3)cs2)cc1)c1ccccc1F |
| InChI | InChI=1S/C23H15ClFN3O2S/c24-17-9-7-16(8-10-17)21-14-31-23(27-21)28-26-13-15-5-11-18(12-6-15)30-22(29)19-3-1-2-4-20(19)25/h1-14H,(H,27,28)/b26-13- |
| InChIKey | YQJBZEZHTJEHRC-ZMFRSBBQSA-N |
| XLogP | 6.27 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|