C20H17N3O2S — CID 168578721
[4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] cyclopropanecarboxylate (PubChem CID 168578721) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is [4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] cyclopropanecarboxylate.
| Compound Name | [4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 168578721 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | [4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] cyclopropanecarboxylate |
| SMILES | O=C(Oc1ccc(C=NNc2nc(-c3ccccc3)cs2)cc1)C1CC1 |
| InChI | InChI=1S/C20H17N3O2S/c24-19(16-8-9-16)25-17-10-6-14(7-11-17)12-21-23-20-22-18(13-26-20)15-4-2-1-3-5-15/h1-7,10-13,16H,8-9H2,(H,22,23) |
| InChIKey | AWCQKKNGAZHSSD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|