C16H14BN3O2S — CID 168576674
[4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]boronic acid (PubChem CID 168576674) has the molecular formula C16H14BN3O2S and a molecular weight of 323.19 g/mol. Its IUPAC name is [4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]boronic acid.
| Compound Name | [4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 168576674 |
| Molecular Formula | C16H14BN3O2S |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | [4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(C=NNc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C16H14BN3O2S/c21-17(22)14-8-6-12(7-9-14)10-18-20-16-19-15(11-23-16)13-4-2-1-3-5-13/h1-11,21-22H,(H,19,20) |
| InChIKey | UVWPGBDYPOEHEF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|