C17H12F3N3S2 — CID 168577407
4-phenyl-N-[[4-(trifluoromethylsulfanyl)phenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 168577407) has the molecular formula C17H12F3N3S2 and a molecular weight of 379.43 g/mol. Its IUPAC name is 4-phenyl-N-[[4-(trifluoromethylsulfanyl)phenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-phenyl-N-[[4-(trifluoromethylsulfanyl)phenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168577407 |
| Molecular Formula | C17H12F3N3S2 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 4-phenyl-N-[[4-(trifluoromethylsulfanyl)phenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | FC(F)(F)Sc1ccc(C=NNc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C17H12F3N3S2/c18-17(19,20)25-14-8-6-12(7-9-14)10-21-23-16-22-15(11-24-16)13-4-2-1-3-5-13/h1-11H,(H,22,23) |
| InChIKey | CCOFCOVZIKGLPP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|