C22H15F3N4S — CID 168577659
4-phenyl-N-[[4-[3-(trifluoromethyl)-2-pyridinyl]phenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 168577659) has the molecular formula C22H15F3N4S and a molecular weight of 424.45 g/mol. Its IUPAC name is 4-phenyl-N-[[4-[3-(trifluoromethyl)-2-pyridinyl]phenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-phenyl-N-[[4-[3-(trifluoromethyl)-2-pyridinyl]phenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168577659 |
| Molecular Formula | C22H15F3N4S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 4-phenyl-N-[[4-[3-(trifluoromethyl)-2-pyridinyl]phenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | FC(F)(F)c1cccnc1-c1ccc(C=NNc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C22H15F3N4S/c23-22(24,25)18-7-4-12-26-20(18)17-10-8-15(9-11-17)13-27-29-21-28-19(14-30-21)16-5-2-1-3-6-16/h1-14H,(H,28,29) |
| InChIKey | AWKAIZPIHLKGHG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|