C17H12F3N3OS — CID 169091862
4-[2-[2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol (PubChem CID 169091862) has the molecular formula C17H12F3N3OS and a molecular weight of 363.36 g/mol. Its IUPAC name is 4-[2-[2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol.
| Compound Name | 4-[2-[2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol |
|---|---|
| PubChem CID | 169091862 |
| Molecular Formula | C17H12F3N3OS |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 4-[2-[2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol |
| SMILES | Oc1ccc(-c2csc(NN=Cc3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C17H12F3N3OS/c18-17(19,20)13-5-1-11(2-6-13)9-21-23-16-22-15(10-25-16)12-3-7-14(24)8-4-12/h1-10,24H,(H,22,23) |
| InChIKey | UJRIQLZKWJAYBV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|