C18H19BrN4OS — CID 172885903
4-[2-[(2E)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol;hydrobromide (PubChem CID 172885903) has the molecular formula C18H19BrN4OS and a molecular weight of 419.35 g/mol. Its IUPAC name is 4-[2-[(2E)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol;hydrobromide.
| Compound Name | 4-[2-[(2E)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol;hydrobromide |
|---|---|
| PubChem CID | 172885903 |
| Molecular Formula | C18H19BrN4OS |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 4-[2-[(2E)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol;hydrobromide |
| SMILES | Br.CN(C)c1ccc(/C=N/Nc2nc(-c3ccc(O)cc3)cs2)cc1 |
| InChI | InChI=1S/C18H18N4OS.BrH/c1-22(2)15-7-3-13(4-8-15)11-19-21-18-20-17(12-24-18)14-5-9-16(23)10-6-14;/h3-12,23H,1-2H3,(H,20,21);1H/b19-11+; |
| InChIKey | VKRYMCBYAJYUGF-YLFUTEQJSA-N |
| XLogP | 4.61 |
| TPSA | 60.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|