C23H27N5O2S2 — CID 5230092
N-[[4-(dimethylamino)phenyl]methylideneamino]-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine (PubChem CID 5230092) has the molecular formula C23H27N5O2S2 and a molecular weight of 469.64 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methylideneamino]-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[[4-(dimethylamino)phenyl]methylideneamino]-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 5230092 |
| Molecular Formula | C23H27N5O2S2 |
| Molecular Weight | 469.64 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methylideneamino]-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine |
| SMILES | CN(C)c1ccc(C=NNc2nc(-c3ccc(S(=O)(=O)N4CCCCC4)cc3)cs2)cc1 |
| InChI | InChI=1S/C23H27N5O2S2/c1-27(2)20-10-6-18(7-11-20)16-24-26-23-25-22(17-31-23)19-8-12-21(13-9-19)32(29,30)28-14-4-3-5-15-28/h6-13,16-17H,3-5,14-15H2,1-2H3,(H,25,26) |
| InChIKey | KXUVZMPBFPPYRT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|