C24H26N4O2S2 — CID 4659241
4-[4-(azepan-1-ylsulfonyl)phenyl]-N-(cinnamylideneamino)-1,3-thiazol-2-amine (PubChem CID 4659241) has the molecular formula C24H26N4O2S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 4-[4-(azepan-1-ylsulfonyl)phenyl]-N-(cinnamylideneamino)-1,3-thiazol-2-amine.
| Compound Name | 4-[4-(azepan-1-ylsulfonyl)phenyl]-N-(cinnamylideneamino)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 4659241 |
| Molecular Formula | C24H26N4O2S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 4-[4-(azepan-1-ylsulfonyl)phenyl]-N-(cinnamylideneamino)-1,3-thiazol-2-amine |
| SMILES | O=S(=O)(c1ccc(-c2csc(NN=CC=Cc3ccccc3)n2)cc1)N1CCCCCC1 |
| InChI | InChI=1S/C24H26N4O2S2/c29-32(30,28-17-6-1-2-7-18-28)22-14-12-21(13-15-22)23-19-31-24(26-23)27-25-16-8-11-20-9-4-3-5-10-20/h3-5,8-16,19H,1-2,6-7,17-18H2,(H,26,27) |
| InChIKey | NWLAEZSIPMJQOZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|