C16H19N3O2S2 — CID 8961871
N-prop-2-enyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine (PubChem CID 8961871) has the molecular formula C16H19N3O2S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is N-prop-2-enyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-prop-2-enyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 8961871 |
| Molecular Formula | C16H19N3O2S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-prop-2-enyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine |
| SMILES | C=CCNc1nc(-c2ccc(S(=O)(=O)N3CCCC3)cc2)cs1 |
| InChI | InChI=1S/C16H19N3O2S2/c1-2-9-17-16-18-15(12-22-16)13-5-7-14(8-6-13)23(20,21)19-10-3-4-11-19/h2,5-8,12H,1,3-4,9-11H2,(H,17,18) |
| InChIKey | RQLCUOLCTOJEEG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|