C14H17N3O2S2 — CID 17405572
N,N-dimethyl-4-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]benzenesulfonamide (PubChem CID 17405572) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 17405572 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | N,N-dimethyl-4-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]benzenesulfonamide |
| SMILES | C=CCNc1nc(-c2ccc(S(=O)(=O)N(C)C)cc2)cs1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-4-9-15-14-16-13(10-20-14)11-5-7-12(8-6-11)21(18,19)17(2)3/h4-8,10H,1,9H2,2-3H3,(H,15,16) |
| InChIKey | YBLPHSYZJFBILK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|