C15H15Cl2N3O3S2 — CID 78868548
2,2-dichloro-N-[4-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazol-2-yl]cyclopropane-1-carboxamide (PubChem CID 78868548) has the molecular formula C15H15Cl2N3O3S2 and a molecular weight of 420.34 g/mol. Its IUPAC name is 2,2-dichloro-N-[4-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazol-2-yl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[4-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazol-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78868548 |
| Molecular Formula | C15H15Cl2N3O3S2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 418.99 |
| IUPAC Name | 2,2-dichloro-N-[4-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazol-2-yl]cyclopropane-1-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2csc(NC(=O)C3CC3(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C15H15Cl2N3O3S2/c1-20(2)25(22,23)10-5-3-9(4-6-10)12-8-24-14(18-12)19-13(21)11-7-15(11,16)17/h3-6,8,11H,7H2,1-2H3,(H,18,19,21) |
| InChIKey | XWRKEEIGDRLHBF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|