C17H16ClN3O2S2 — CID 58911132
4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 58911132) has the molecular formula C17H16ClN3O2S2 and a molecular weight of 393.92 g/mol. Its IUPAC name is 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 58911132 |
| Molecular Formula | C17H16ClN3O2S2 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2csc(Nc3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C17H16ClN3O2S2/c1-21(2)25(22,23)15-9-3-12(4-10-15)16-11-24-17(20-16)19-14-7-5-13(18)6-8-14/h3-11H,1-2H3,(H,19,20) |
| InChIKey | FAPAIMVPWMPYIL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |