C17H16N2O3S2 — CID 17398323
N-(4-methoxyphenyl)-4-(4-methylsulfonylphenyl)-1,3-thiazol-2-amine (PubChem CID 17398323) has the molecular formula C17H16N2O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-(4-methylsulfonylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(4-methoxyphenyl)-4-(4-methylsulfonylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 17398323 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | N-(4-methoxyphenyl)-4-(4-methylsulfonylphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(Nc2nc(-c3ccc(S(C)(=O)=O)cc3)cs2)cc1 |
| InChI | InChI=1S/C17H16N2O3S2/c1-22-14-7-5-13(6-8-14)18-17-19-16(11-23-17)12-3-9-15(10-4-12)24(2,20)21/h3-11H,1-2H3,(H,18,19) |
| InChIKey | QIZYBHGSPMDGLN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |