C16H13BrN2O2S2 — CID 24505641
N-(3-bromophenyl)-4-(4-methylsulfonylphenyl)-1,3-thiazol-2-amine (PubChem CID 24505641) has the molecular formula C16H13BrN2O2S2 and a molecular weight of 409.33 g/mol. Its IUPAC name is N-(3-bromophenyl)-4-(4-methylsulfonylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(3-bromophenyl)-4-(4-methylsulfonylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 24505641 |
| Molecular Formula | C16H13BrN2O2S2 |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | N-(3-bromophenyl)-4-(4-methylsulfonylphenyl)-1,3-thiazol-2-amine |
| SMILES | CS(=O)(=O)c1ccc(-c2csc(Nc3cccc(Br)c3)n2)cc1 |
| InChI | InChI=1S/C16H13BrN2O2S2/c1-23(20,21)14-7-5-11(6-8-14)15-10-22-16(19-15)18-13-4-2-3-12(17)9-13/h2-10H,1H3,(H,18,19) |
| InChIKey | ZVBMOINCIRTTKM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |