C17H17N3O4S3 — CID 175544584
2-methyl-4-[2-(4-methylsulfonylanilino)-1,3-thiazol-4-yl]benzenesulfonamide (PubChem CID 175544584) has the molecular formula C17H17N3O4S3 and a molecular weight of 423.54 g/mol. Its IUPAC name is 2-methyl-4-[2-(4-methylsulfonylanilino)-1,3-thiazol-4-yl]benzenesulfonamide.
| Compound Name | 2-methyl-4-[2-(4-methylsulfonylanilino)-1,3-thiazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 175544584 |
| Molecular Formula | C17H17N3O4S3 |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | 2-methyl-4-[2-(4-methylsulfonylanilino)-1,3-thiazol-4-yl]benzenesulfonamide |
| SMILES | Cc1cc(-c2csc(Nc3ccc(S(C)(=O)=O)cc3)n2)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C17H17N3O4S3/c1-11-9-12(3-8-16(11)27(18,23)24)15-10-25-17(20-15)19-13-4-6-14(7-5-13)26(2,21)22/h3-10H,1-2H3,(H,19,20)(H2,18,23,24) |
| InChIKey | SHKZNCRMPQPFCU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |