C15H12N4O4S2 — CID 90730964
4-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide (PubChem CID 90730964) has the molecular formula C15H12N4O4S2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 4-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 90730964 |
| Molecular Formula | C15H12N4O4S2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 4-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2nc(-c3ccc([N+](=O)[O-])cc3)cs2)cc1 |
| InChI | InChI=1S/C15H12N4O4S2/c16-25(22,23)13-7-3-11(4-8-13)17-15-18-14(9-24-15)10-1-5-12(6-2-10)19(20)21/h1-9H,(H,17,18)(H2,16,22,23) |
| InChIKey | HIMYCLQBSPLNHG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|