C28H28BrN5O6S2 — CID 160990265
ethyl 4-(carbamothioylamino)benzoate;ethyl 4-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]benzoate;hydrobromide (PubChem CID 160990265) has the molecular formula C28H28BrN5O6S2 and a molecular weight of 674.60 g/mol. Its IUPAC name is ethyl 4-(carbamothioylamino)benzoate;ethyl 4-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]benzoate;hydrobromide.
| Compound Name | ethyl 4-(carbamothioylamino)benzoate;ethyl 4-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]benzoate;hydrobromide |
|---|---|
| PubChem CID | 160990265 |
| Molecular Formula | C28H28BrN5O6S2 |
| Molecular Weight | 674.60 g/mol |
| Exact Mass | 673.07 |
| IUPAC Name | ethyl 4-(carbamothioylamino)benzoate;ethyl 4-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]benzoate;hydrobromide |
| SMILES | Br.CCOC(=O)c1ccc(NC(N)=S)cc1.CCOC(=O)c1ccc(Nc2nc(-c3ccc([N+](=O)[O-])cc3)cs2)cc1 |
| InChI | InChI=1S/C18H15N3O4S.C10H12N2O2S.BrH/c1-2-25-17(22)13-3-7-14(8-4-13)19-18-20-16(11-26-18)12-5-9-15(10-6-12)21(23)24;1-2-14-9(13)7-3-5-8(6-4-7)12-10(11)15;/h3-11H,2H2,1H3,(H,19,20);3-6H,2H2,1H3,(H3,11,12,15);1H |
| InChIKey | YYZVNWIVZUZLOJ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 158.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.60 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|