C28H22N8O2S2 — CID 158527700
N-(4-nitrophenyl)-4-pyridin-4-yl-1,3-thiazol-2-amine;4-N-(4-pyridin-4-yl-1,3-thiazol-2-yl)benzene-1,4-diamine (PubChem CID 158527700) has the molecular formula C28H22N8O2S2 and a molecular weight of 566.67 g/mol. Its IUPAC name is N-(4-nitrophenyl)-4-pyridin-4-yl-1,3-thiazol-2-amine;4-N-(4-pyridin-4-yl-1,3-thiazol-2-yl)benzene-1,4-diamine.
| Compound Name | N-(4-nitrophenyl)-4-pyridin-4-yl-1,3-thiazol-2-amine;4-N-(4-pyridin-4-yl-1,3-thiazol-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 158527700 |
| Molecular Formula | C28H22N8O2S2 |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | N-(4-nitrophenyl)-4-pyridin-4-yl-1,3-thiazol-2-amine;4-N-(4-pyridin-4-yl-1,3-thiazol-2-yl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2nc(-c3ccncc3)cs2)cc1.O=[N+]([O-])c1ccc(Nc2nc(-c3ccncc3)cs2)cc1 |
| InChI | InChI=1S/C14H10N4O2S.C14H12N4S/c19-18(20)12-3-1-11(2-4-12)16-14-17-13(9-21-14)10-5-7-15-8-6-10;15-11-1-3-12(4-2-11)17-14-18-13(9-19-14)10-5-7-16-8-6-10/h1-9H,(H,16,17);1-9H,15H2,(H,17,18) |
| InChIKey | HMZFMCWMYMXZLE-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|