C16H13N3O2S — CID 135223031
4-(2-methylphenyl)-N-(4-nitrophenyl)-1,3-thiazol-2-amine (PubChem CID 135223031) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is 4-(2-methylphenyl)-N-(4-nitrophenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2-methylphenyl)-N-(4-nitrophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 135223031 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 4-(2-methylphenyl)-N-(4-nitrophenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1ccccc1-c1csc(Nc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C16H13N3O2S/c1-11-4-2-3-5-14(11)15-10-22-16(18-15)17-12-6-8-13(9-7-12)19(20)21/h2-10H,1H3,(H,17,18) |
| InChIKey | SZYOJTSGDHXDMW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|