C18H13N5O3S — CID 112821488
N-[4-(2-methylphenyl)-1,3-thiazol-2-yl]-5-nitro-1H-indazole-3-carboxamide (PubChem CID 112821488) has the molecular formula C18H13N5O3S and a molecular weight of 379.40 g/mol. Its IUPAC name is N-[4-(2-methylphenyl)-1,3-thiazol-2-yl]-5-nitro-1H-indazole-3-carboxamide.
| Compound Name | N-[4-(2-methylphenyl)-1,3-thiazol-2-yl]-5-nitro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 112821488 |
| Molecular Formula | C18H13N5O3S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | N-[4-(2-methylphenyl)-1,3-thiazol-2-yl]-5-nitro-1H-indazole-3-carboxamide |
| SMILES | Cc1ccccc1-c1csc(NC(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)n1 |
| InChI | InChI=1S/C18H13N5O3S/c1-10-4-2-3-5-12(10)15-9-27-18(19-15)20-17(24)16-13-8-11(23(25)26)6-7-14(13)21-22-16/h2-9H,1H3,(H,21,22)(H,19,20,24) |
| InChIKey | YEFSKVJSSKJIMM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|