C18H15N3O3S — CID 3331893
N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide (PubChem CID 3331893) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide.
| Compound Name | N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3331893 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide |
| SMILES | Cc1ccc(C)c(-c2csc(NC(=O)c3cccc([N+](=O)[O-])c3)n2)c1 |
| InChI | InChI=1S/C18H15N3O3S/c1-11-6-7-12(2)15(8-11)16-10-25-18(19-16)20-17(22)13-4-3-5-14(9-13)21(23)24/h3-10H,1-2H3,(H,19,20,22) |
| InChIKey | AARLAXDEYXDGIV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|