C26H16N6O6S2 — CID 3602567
1-N,3-N-bis[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,3-dicarboxamide (PubChem CID 3602567) has the molecular formula C26H16N6O6S2 and a molecular weight of 572.58 g/mol. Its IUPAC name is 1-N,3-N-bis[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 3602567 |
| Molecular Formula | C26H16N6O6S2 |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 572.06 |
| IUPAC Name | 1-N,3-N-bis[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1nc(-c2ccc([N+](=O)[O-])cc2)cs1)c1cccc(C(=O)Nc2nc(-c3ccc([N+](=O)[O-])cc3)cs2)c1 |
| InChI | InChI=1S/C26H16N6O6S2/c33-23(29-25-27-21(13-39-25)15-4-8-19(9-5-15)31(35)36)17-2-1-3-18(12-17)24(34)30-26-28-22(14-40-26)16-6-10-20(11-7-16)32(37)38/h1-14H,(H,27,29,33)(H,28,30,34) |
| InChIKey | OXEYGKXNHWZSRY-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 170.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|