C24H15N3O5S — CID 19176230
N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-4-(2-oxo-2-phenylacetyl)benzamide (PubChem CID 19176230) has the molecular formula C24H15N3O5S and a molecular weight of 457.47 g/mol. Its IUPAC name is N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-4-(2-oxo-2-phenylacetyl)benzamide.
| Compound Name | N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-4-(2-oxo-2-phenylacetyl)benzamide |
|---|---|
| PubChem CID | 19176230 |
| Molecular Formula | C24H15N3O5S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-4-(2-oxo-2-phenylacetyl)benzamide |
| SMILES | O=C(Nc1nc(-c2ccc([N+](=O)[O-])cc2)cs1)c1ccc(C(=O)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H15N3O5S/c28-21(16-4-2-1-3-5-16)22(29)17-6-8-18(9-7-17)23(30)26-24-25-20(14-33-24)15-10-12-19(13-11-15)27(31)32/h1-14H,(H,25,26,30) |
| InChIKey | KTSDIEXHQVVYDT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|