C11H6F3N3O3S — CID 5130084
2,2,2-trifluoro-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 5130084) has the molecular formula C11H6F3N3O3S and a molecular weight of 317.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 5130084 |
| Molecular Formula | C11H6F3N3O3S |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 2,2,2-trifluoro-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(Nc1nc(-c2ccc([N+](=O)[O-])cc2)cs1)C(F)(F)F |
| InChI | InChI=1S/C11H6F3N3O3S/c12-11(13,14)9(18)16-10-15-8(5-21-10)6-1-3-7(4-2-6)17(19)20/h1-5H,(H,15,16,18) |
| InChIKey | LZDVECCTOJFNPU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|