C16H11ClN4O3S — CID 4078223
1-(3-chlorophenyl)-3-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]urea (PubChem CID 4078223) has the molecular formula C16H11ClN4O3S and a molecular weight of 374.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 4078223 |
| Molecular Formula | C16H11ClN4O3S |
| Molecular Weight | 374.81 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1nc(-c2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C16H11ClN4O3S/c17-11-2-1-3-12(8-11)18-15(22)20-16-19-14(9-25-16)10-4-6-13(7-5-10)21(23)24/h1-9H,(H2,18,19,20,22) |
| InChIKey | ZJYKAXUYGKBVAQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.81 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|