C19H13ClN6O4S2 — CID 41211519
2-[2-[(3-chlorophenyl)carbamoylamino]-1,3-thiazol-4-yl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 41211519) has the molecular formula C19H13ClN6O4S2 and a molecular weight of 488.94 g/mol. Its IUPAC name is 2-[2-[(3-chlorophenyl)carbamoylamino]-1,3-thiazol-4-yl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-[2-[(3-chlorophenyl)carbamoylamino]-1,3-thiazol-4-yl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 41211519 |
| Molecular Formula | C19H13ClN6O4S2 |
| Molecular Weight | 488.94 g/mol |
| Exact Mass | 488.01 |
| IUPAC Name | 2-[2-[(3-chlorophenyl)carbamoylamino]-1,3-thiazol-4-yl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | O=C(Cc1csc(NC(=O)Nc2cccc(Cl)c2)n1)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C19H13ClN6O4S2/c20-10-2-1-3-11(6-10)21-17(28)25-18-22-12(9-31-18)7-16(27)24-19-23-14-5-4-13(26(29)30)8-15(14)32-19/h1-6,8-9H,7H2,(H,23,24,27)(H2,21,22,25,28) |
| InChIKey | VXXSTLMUWQVHMJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.94 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|