C19H13ClN6O4S2 — CID 16897523
2-[(3-chlorophenyl)carbamoylamino]-4-methyl-N-(6-nitro-1,3-benzothiazol-2-yl)-1,3-thiazole-5-carboxamide (PubChem CID 16897523) has the molecular formula C19H13ClN6O4S2 and a molecular weight of 488.94 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)carbamoylamino]-4-methyl-N-(6-nitro-1,3-benzothiazol-2-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(3-chlorophenyl)carbamoylamino]-4-methyl-N-(6-nitro-1,3-benzothiazol-2-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 16897523 |
| Molecular Formula | C19H13ClN6O4S2 |
| Molecular Weight | 488.94 g/mol |
| Exact Mass | 488.01 |
| IUPAC Name | 2-[(3-chlorophenyl)carbamoylamino]-4-methyl-N-(6-nitro-1,3-benzothiazol-2-yl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(NC(=O)Nc2cccc(Cl)c2)sc1C(=O)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C19H13ClN6O4S2/c1-9-15(32-18(21-9)25-17(28)22-11-4-2-3-10(20)7-11)16(27)24-19-23-13-6-5-12(26(29)30)8-14(13)31-19/h2-8H,1H3,(H,23,24,27)(H2,21,22,25,28) |
| InChIKey | ZWQPCMNQXZCFOC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.94 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|