C14H10ClN3OS — CID 834850
1-(1,3-benzothiazol-2-yl)-3-(3-chlorophenyl)urea (PubChem CID 834850) has the molecular formula C14H10ClN3OS and a molecular weight of 303.77 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-(3-chlorophenyl)urea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 834850 |
| Molecular Formula | C14H10ClN3OS |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-(3-chlorophenyl)urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H10ClN3OS/c15-9-4-3-5-10(8-9)16-13(19)18-14-17-11-6-1-2-7-12(11)20-14/h1-8H,(H2,16,17,18,19) |
| InChIKey | KIJFMBMCWLDPPH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |