C16H11ClN2OS — CID 7733875
(E)-3-(1,3-benzothiazol-2-yl)-N-(3-chlorophenyl)prop-2-enamide (PubChem CID 7733875) has the molecular formula C16H11ClN2OS and a molecular weight of 314.80 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-(3-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-(3-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7733875 |
| Molecular Formula | C16H11ClN2OS |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-(3-chlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H11ClN2OS/c17-11-4-3-5-12(10-11)18-15(20)8-9-16-19-13-6-1-2-7-14(13)21-16/h1-10H,(H,18,20)/b9-8+ |
| InChIKey | FNJJCHDGDPDLSU-CMDGGOBGSA-N |
| XLogP | 4.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|