C25H21N3O4S — CID 55888506
(E)-3-(1,3-benzothiazol-2-yl)-N-[3-[[2-(2-methoxyphenoxy)acetyl]amino]phenyl]prop-2-enamide (PubChem CID 55888506) has the molecular formula C25H21N3O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-[3-[[2-(2-methoxyphenoxy)acetyl]amino]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[3-[[2-(2-methoxyphenoxy)acetyl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55888506 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[3-[[2-(2-methoxyphenoxy)acetyl]amino]phenyl]prop-2-enamide |
| SMILES | COc1ccccc1OCC(=O)Nc1cccc(NC(=O)/C=C/c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C25H21N3O4S/c1-31-20-10-3-4-11-21(20)32-16-24(30)27-18-8-6-7-17(15-18)26-23(29)13-14-25-28-19-9-2-5-12-22(19)33-25/h2-15H,16H2,1H3,(H,26,29)(H,27,30)/b14-13+ |
| InChIKey | VGPZOFQCCZMUGM-BUHFOSPRSA-N |
| XLogP | 4.97 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|