C19H15N5OS — CID 75375301
(E)-3-(1,3-benzothiazol-2-yl)-N-[3-(1,2,4-triazol-4-ylmethyl)phenyl]prop-2-enamide (PubChem CID 75375301) has the molecular formula C19H15N5OS and a molecular weight of 361.43 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-[3-(1,2,4-triazol-4-ylmethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[3-(1,2,4-triazol-4-ylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 75375301 |
| Molecular Formula | C19H15N5OS |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[3-(1,2,4-triazol-4-ylmethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)Nc1cccc(Cn2cnnc2)c1 |
| InChI | InChI=1S/C19H15N5OS/c25-18(8-9-19-23-16-6-1-2-7-17(16)26-19)22-15-5-3-4-14(10-15)11-24-12-20-21-13-24/h1-10,12-13H,11H2,(H,22,25)/b9-8+ |
| InChIKey | YRDSJYJUBVRPAJ-CMDGGOBGSA-N |
| XLogP | 3.59 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|