C19H14N2O3S — CID 67865819
4-[3-[2-(1,3-benzothiazol-2-yl)ethenyl]anilino]-4-oxobut-2-enoic acid (PubChem CID 67865819) has the molecular formula C19H14N2O3S and a molecular weight of 350.40 g/mol. Its IUPAC name is 4-[3-[2-(1,3-benzothiazol-2-yl)ethenyl]anilino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[3-[2-(1,3-benzothiazol-2-yl)ethenyl]anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 67865819 |
| Molecular Formula | C19H14N2O3S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 4-[3-[2-(1,3-benzothiazol-2-yl)ethenyl]anilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)Nc1cccc(C=Cc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C19H14N2O3S/c22-17(9-11-19(23)24)20-14-5-3-4-13(12-14)8-10-18-21-15-6-1-2-7-16(15)25-18/h1-12H,(H,20,22)(H,23,24) |
| InChIKey | WGPICJXOYMUOTE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|