C16H10ClN3O3S — CID 55363488
(E)-3-(1,3-benzothiazol-2-yl)-N-(4-chloro-3-nitrophenyl)prop-2-enamide (PubChem CID 55363488) has the molecular formula C16H10ClN3O3S and a molecular weight of 359.79 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-(4-chloro-3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-(4-chloro-3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55363488 |
| Molecular Formula | C16H10ClN3O3S |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-(4-chloro-3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10ClN3O3S/c17-11-6-5-10(9-13(11)20(22)23)18-15(21)7-8-16-19-12-3-1-2-4-14(12)24-16/h1-9H,(H,18,21)/b8-7+ |
| InChIKey | QPSQMBDJTUNGOC-BQYQJAHWSA-N |
| XLogP | 4.51 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|