C18H13ClN4O4S — CID 6045967
(E)-N-(6-acetamido-1,3-benzothiazol-2-yl)-3-(4-chloro-3-nitrophenyl)prop-2-enamide (PubChem CID 6045967) has the molecular formula C18H13ClN4O4S and a molecular weight of 416.85 g/mol. Its IUPAC name is (E)-N-(6-acetamido-1,3-benzothiazol-2-yl)-3-(4-chloro-3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-(6-acetamido-1,3-benzothiazol-2-yl)-3-(4-chloro-3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6045967 |
| Molecular Formula | C18H13ClN4O4S |
| Molecular Weight | 416.85 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | (E)-N-(6-acetamido-1,3-benzothiazol-2-yl)-3-(4-chloro-3-nitrophenyl)prop-2-enamide |
| SMILES | CC(=O)Nc1ccc2nc(NC(=O)/C=C/c3ccc(Cl)c([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C18H13ClN4O4S/c1-10(24)20-12-4-6-14-16(9-12)28-18(21-14)22-17(25)7-3-11-2-5-13(19)15(8-11)23(26)27/h2-9H,1H3,(H,20,24)(H,21,22,25)/b7-3+ |
| InChIKey | MCYVYLSZTJWREE-XVNBXDOJSA-N |
| XLogP | 4.47 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.85 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|