C19H18N4O4S2 — CID 56572225
(E)-N-(6-acetamido-1,3-benzothiazol-2-yl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide (PubChem CID 56572225) has the molecular formula C19H18N4O4S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is (E)-N-(6-acetamido-1,3-benzothiazol-2-yl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(6-acetamido-1,3-benzothiazol-2-yl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 56572225 |
| Molecular Formula | C19H18N4O4S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | (E)-N-(6-acetamido-1,3-benzothiazol-2-yl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
| SMILES | CC(=O)Nc1ccc2nc(NC(=O)/C=C/c3ccc(NS(C)(=O)=O)cc3)sc2c1 |
| InChI | InChI=1S/C19H18N4O4S2/c1-12(24)20-15-8-9-16-17(11-15)28-19(21-16)22-18(25)10-5-13-3-6-14(7-4-13)23-29(2,26)27/h3-11,23H,1-2H3,(H,20,24)(H,21,22,25)/b10-5+ |
| InChIKey | YXGGACBCWMRHCE-BJMVGYQFSA-N |
| XLogP | 3.28 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|