C20H18FN3O3S2 — CID 76870485
N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]-3-[4-(methanesulfonamido)phenyl]prop-2-enamide (PubChem CID 76870485) has the molecular formula C20H18FN3O3S2 and a molecular weight of 431.51 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]-3-[4-(methanesulfonamido)phenyl]prop-2-enamide.
| Compound Name | N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76870485 |
| Molecular Formula | C20H18FN3O3S2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
| SMILES | Cc1sc(NC(=O)C=Cc2ccc(NS(C)(=O)=O)cc2)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H18FN3O3S2/c1-13-19(15-6-8-16(21)9-7-15)23-20(28-13)22-18(25)12-5-14-3-10-17(11-4-14)24-29(2,26)27/h3-12,24H,1-2H3,(H,22,23,25) |
| InChIKey | CNXTTYXGFXBYLO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|