C19H14BrClN2OS — CID 19211880
(E)-N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 19211880) has the molecular formula C19H14BrClN2OS and a molecular weight of 433.76 g/mol. Its IUPAC name is (E)-N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19211880 |
| Molecular Formula | C19H14BrClN2OS |
| Molecular Weight | 433.76 g/mol |
| Exact Mass | 431.97 |
| IUPAC Name | (E)-N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | Cc1sc(NC(=O)/C=C/c2ccc(Cl)cc2)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H14BrClN2OS/c1-12-18(14-5-7-15(20)8-6-14)23-19(25-12)22-17(24)11-4-13-2-9-16(21)10-3-13/h2-11H,1H3,(H,22,23,24)/b11-4+ |
| InChIKey | FGSBDMRHBSHINJ-NYYWCZLTSA-N |
| XLogP | 6.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.76 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|