C17H13FN2O3S2 — CID 2666768
(E)-3-(3-fluorophenyl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 2666768) has the molecular formula C17H13FN2O3S2 and a molecular weight of 376.43 g/mol. Its IUPAC name is (E)-3-(3-fluorophenyl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(3-fluorophenyl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2666768 |
| Molecular Formula | C17H13FN2O3S2 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | (E)-3-(3-fluorophenyl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=O)/C=C/c3cccc(F)c3)sc2c1 |
| InChI | InChI=1S/C17H13FN2O3S2/c1-25(22,23)13-6-7-14-15(10-13)24-17(19-14)20-16(21)8-5-11-3-2-4-12(18)9-11/h2-10H,1H3,(H,19,20,21)/b8-5+ |
| InChIKey | CDFFSVXSXDIUQM-VMPITWQZSA-N |
| XLogP | 3.49 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|