C16H12F2N2O3S2 — CID 167986896
2-(2,5-difluorophenyl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)acetamide (PubChem CID 167986896) has the molecular formula C16H12F2N2O3S2 and a molecular weight of 382.41 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(2,5-difluorophenyl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 167986896 |
| Molecular Formula | C16H12F2N2O3S2 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 2-(2,5-difluorophenyl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=O)Cc3cc(F)ccc3F)sc2c1 |
| InChI | InChI=1S/C16H12F2N2O3S2/c1-25(22,23)11-3-5-13-14(8-11)24-16(19-13)20-15(21)7-9-6-10(17)2-4-12(9)18/h2-6,8H,7H2,1H3,(H,19,20,21) |
| InChIKey | WGUOZJKMWQEPGM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |